CAS 57443-18-2

Dimethyl(benzyloxycarbonyl)methyl phosphonate

Description:

Dimethyl(benzyloxycarbonyl)methyl phosphonate, with the CAS number 57443-18-2, is a chemical compound characterized by its phosphonate functional group, which is a derivative of phosphonic acid. This compound features a dimethyl ester structure, where two methyl groups are attached to the phosphonate moiety. The presence of a benzyloxycarbonyl group indicates that it has a benzyl group linked to a carbonyl, contributing to its reactivity and potential applications in organic synthesis. Typically, compounds like this are used in the synthesis of various organic molecules, including pharmaceuticals and agrochemicals, due to their ability to act as intermediates in chemical reactions. The phosphonate group is known for its stability and ability to form strong bonds with biological molecules, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific solubility characteristics and reactivity patterns, which can be influenced by the presence of the benzyloxycarbonyl group. Overall, Dimethyl(benzyloxycarbonyl)methyl phosphonate is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₁₁H₁₅O₅P

InChI: InChI=1/C11H15O5P/c1-14-17(13,15-2)9-11(12)16-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3

SMILES: COP(=O)(CC(=O)OCc1ccccc1)OC

Synonyms:

• Benzyl (Dimethoxyphosphoryl)Acetate
• Benzyl Dimethyl Phosphonoacetate

Benzyl Dimethylphosphonoacetate

CAS: 57443-18-2

Formula: C₁₁H₁₅O₅P

Purity: >97.0%(GC)

Color and Shape: Colorless to Light yellow to Light orange clear liquid

Molecular weight: 258.21

Ref: 3B-B2815

Benzyl Dimethylphosphonoacetate

CAS: 57443-18-2

Formula: C₁₁H₁₅O₅P

Purity: 97%

Color and Shape: Liquid

Molecular weight: 258.2076

Ref: IN-DA003O45

Dimethyl (benzyloxycarbonyl)methylphosphonate

CAS: 57443-18-2

Dimethyl (benzyloxycarbonyl)methylphosphonate

Formula: C₁₁H₁₅O₅P

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 258.20756g/mol

Ref: 54-OR10755

Benzyl 2-(dimethoxyphosphoryl)acetate

CAS: 57443-18-2

Purity: 97%

Molecular weight: 258.2099915

Ref: 10-F634330

Benzyl Dimethylphosphonoacetate

CAS: 57443-18-2

Benzyl dimethylphosphonoacetate (BDP) is a chiral compound that has been used as a fluorophore, and has shown to be an enhancer for fluorescence. It has also been used in the synthesis of carboxylic acids and hydroxyl groups. BDP is unsymmetrical, containing both a c1-c6 alkoxy group and a halogeno group. The hydroxyl group makes it useful for lipid synthesis, while the halogeno group gives it the ability to bind to cholesterol. BDP also has neuropathic effects and can inhibit macrolide resistance. The c1-c6 alkoxy group allows it to act as a hydroxamic acid, which inhibits cholesterol synthesis by inhibiting HMG-CoA reductase. Finally, its fluorophore properties allow it to be used in heterocycle synthesis.

Formula: C₁₁H₁₅O₅P

Purity: Min. 95%

Molecular weight: 258.21 g/mol

Ref: 3D-HCA44318