CAS 5745-54-0

11-(4-hydroxyphenyl)-2,2,6,6-tetramethyl-3,4-dihydro-2H,6H,12H-dipyrano[2,3-f:2',3'-h]chromen-12-one

Description:

The chemical substance known as 11-(4-hydroxyphenyl)-2,2,6,6-tetramethyl-3,4-dihydro-2H,6H,12H-dipyrano[2,3-f:2',3'-h]chromen-12-one, with the CAS number 5745-54-0, is a complex organic compound characterized by its polycyclic structure, which includes chromene and dipyran moieties. This compound features a hydroxyl group attached to a phenyl ring, contributing to its potential for hydrogen bonding and increased solubility in polar solvents. The presence of multiple methyl groups enhances its hydrophobic character and may influence its biological activity. It is often studied for its potential applications in pharmaceuticals, particularly due to its antioxidant properties and ability to interact with various biological targets. The compound's unique structural features may also impart specific optical properties, making it of interest in materials science and photonics. Overall, this substance exemplifies the intricate relationship between molecular structure and functional properties in organic chemistry.

Formula: C₂₅H₂₄O₅

InChI: InChI=1/C25H24O5/c1-24(2)11-9-16-21(29-24)17-10-12-25(3,4)30-23(17)19-20(27)18(13-28-22(16)19)14-5-7-15(26)8-6-14/h5-9,11,13,26H,10,12H2,1-4H3

SMILES: CC1(C)C=Cc2c(c3CCC(C)(C)Oc3c3c(=O)c(coc23)c2ccc(cc2)O)O1

Synonyms:

• 2H,6H,12H-benzo[1,2-b:3,4-b':5,6-b'']tripyran-12-one, 3,4-dihydro-11-(4-hydroxyphenyl)-2,2,6,6-tetramethyl-

Iso-Osajin

CAS: 5745-54-0

Iso-Osajin is a naturally occurring compound that falls under the category of prenylated flavonoids. It is isolated from the seeds of Psoralea corylifolia, a plant traditionally used in various medicinal systems. The compound exhibits its mode of action primarily through antimicrobial activities, potentially disrupting microbial cell membranes or inhibiting essential enzymes. Iso-Osajin has been of considerable interest due to its promising pharmacological effects, including antibacterial, antifungal, and possibly antiviral properties.

Formula: C₂₅H₂₄O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 404.46 g/mol

Ref: 3D-FO137933