CAS 57452-97-8
:(S)-(+)-Praziquantel
Description:
(S)-(+)-Praziquantel is a synthetic organic compound primarily used as an anthelmintic medication, effective against various parasitic infections, particularly schistosomiasis. It belongs to the class of isoquinoline derivatives and is characterized by its chiral nature, with the (S)-enantiomer being the biologically active form. The compound exhibits a molecular formula that includes carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its pharmacological properties. Praziquantel works by causing severe spasms and paralysis of the parasites, facilitating their elimination from the host's body. It is typically administered orally and is well-absorbed, with a relatively short half-life. The compound is known for its low toxicity in humans, making it a preferred choice for treating parasitic infections. In terms of physical properties, (S)-(+)-Praziquantel is a crystalline solid, often appearing as a white to off-white powder. Its solubility varies in different solvents, which is important for formulation in pharmaceutical applications. Overall, (S)-(+)-Praziquantel is a crucial agent in the fight against parasitic diseases, with a well-established safety profile.
Formula:C19H24N2O2
InChI:InChI=1S/C19H24N2O2/c22-18-13-20(19(23)15-7-2-1-3-8-15)12-17-16-9-5-4-6-14(16)10-11-21(17)18/h4-6,9,15,17H,1-3,7-8,10-13H2/t17-/m1/s1
SMILES:C1CCC(CC1)C(=O)N1C[C@@H]2c3ccccc3CCN2C(=O)C1
Synonyms:- d-Praziquantel
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
(S)-Praziquantel
CAS:Formula:C19H24N2O2Color and Shape:White To Off-White SolidMolecular weight:312.41(S)-Praziquantel-d11
CAS:Formula:C19H13D11N2O2Color and Shape:White To Off-White SolidMolecular weight:323.48(S)-Praziquantel
CAS:(S)-Praziquantel is the inactive isomer of R-praziquantel.Formula:C19H24N2O2Color and Shape:SolidMolecular weight:312.406
