CAS 57452-98-9
:(R)-(-)-Praziquantel
Description:
(R)-(-)-Praziquantel is a synthetic organic compound primarily used as an anthelmintic agent, effective against various parasitic infections, particularly schistosomiasis. It is characterized by its chiral nature, possessing a specific stereochemistry that contributes to its biological activity. The compound has a molecular formula that includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its complex structure. Praziquantel is typically administered orally and is known for its high solubility in organic solvents, which facilitates its absorption in the gastrointestinal tract. The mechanism of action involves the disruption of the parasite's tegument, leading to paralysis and eventual death of the organism. Additionally, it has a relatively low toxicity profile in humans, making it a preferred choice for treating infections. Its pharmacokinetics indicate rapid absorption and metabolism, with a half-life that allows for effective dosing regimens. Overall, (R)-(-)-Praziquantel is a crucial therapeutic agent in the field of parasitology, demonstrating significant efficacy against a range of helminthic infections.
Formula:C19H24N2O2
InChI:InChI=1S/C19H24N2O2/c22-18-13-20(19(23)15-7-2-1-3-8-15)12-17-16-9-5-4-6-14(16)10-11-21(17)18/h4-6,9,15,17H,1-3,7-8,10-13H2/t17-/m0/s1
SMILES:C1CCC(CC1)C(=O)N1C[C@H]2c3ccccc3CCN2C(=O)C1
Synonyms:- (11bR)-2-(Cyclohexylcarbonyl)-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(R)-Praziquantel
CAS:Formula:C19H24N2O2Color and Shape:White To Off-White SolidMolecular weight:312.41(R)-2-(Cyclohexanecarbonyl)-2,3,6,7-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4(11bH)-one
CAS:(R)-2-(Cyclohexanecarbonyl)-2,3,6,7-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4(11bH)-onePurity:99%Molecular weight:312.41g/mol(R)-Praziquantel
CAS:Controlled ProductFormula:C19H24N2O2Color and Shape:White To Light YellowMolecular weight:312.41(R)-(-)-Praziquantel
CAS:Praziquantel is a drug used to treat worms in animals. It has been shown to be effective against schistosomiasis, as well as other nematodes and cestodes. Praziquantel is a racemic mixture of two enantiomers, (R)-(-)-praziquantel and (S)-(+)-praziquantel. The former is more active than the latter against Schistosoma mansoni. The praziquantel molecule contains a chiral carbon atom, which makes it optically active. Chloride ions are required for the activity of praziquantel, so urine samples must be treated with dilute hydrochloric acid before use in order to remove them or else the drug will not work properly. Praziquantel can also be used to treat human liver cancer and is effective at doses of 1-2 mg/kg/day.Formula:C19H24N2O2Purity:Min. 95%Molecular weight:312.41 g/mol(R)-Praziquantel
CAS:(R)-Praziquantel is an active enantiomer of praziquantel.Formula:C19H24N2O2Purity:98%Color and Shape:SolidMolecular weight:312.41






