CAS 57459-36-6

(3-phenyl-1,2,4-oxadiazol-5-yl)acetonitrile

Description:

(3-Phenyl-1,2,4-oxadiazol-5-yl)acetonitrile is a chemical compound characterized by its oxadiazole ring, which contributes to its unique properties. The oxadiazole moiety is known for its potential applications in pharmaceuticals and materials science due to its ability to participate in various chemical reactions and its stability. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its solubility and reactivity. Acetonitrile, a nitrile functional group, adds to the compound's polarity and can affect its interaction with other substances. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its structure suggests potential applications in organic synthesis, as well as in the development of fluorescent materials or sensors. Overall, (3-phenyl-1,2,4-oxadiazol-5-yl)acetonitrile is a versatile compound with properties that can be tailored for specific applications in various fields of chemistry and material science.

Formula: C₁₀H₇N₃O

InChI: InChI=1/C10H7N3O/c11-7-6-9-12-10(13-14-9)8-4-2-1-3-5-8/h1-5H,6H2

SMILES: c1ccc(cc1)c1nc(CC#N)on1

Synonyms:

• 1,2,4-Oxadiazole-5-Acetonitrile, 3-Phenyl-

2-(3-Phenyl-1,2,4-oxadiazol-5-yl)acetonitrile

CAS: 57459-36-6

Versatile small molecule scaffold

Formula: C₁₀H₇N₃O

Purity: Min. 95%

Molecular weight: 185.18 g/mol

Ref: 3D-HCA45936