CAS 5746-24-7
:2-Methylene-α-oxocyclopropanepropanoic acid
Description:
2-Methylene-α-oxocyclopropanepropanoic acid, with the CAS number 5746-24-7, is an organic compound characterized by its unique cyclopropane structure and the presence of both a methylene and a keto group. This compound typically exhibits a colorless to pale yellow appearance and is soluble in polar solvents due to its carboxylic acid functional group. The presence of the cyclopropane ring contributes to its strain and reactivity, making it a valuable intermediate in organic synthesis. It can participate in various chemical reactions, including nucleophilic additions and cycloadditions, due to the electrophilic nature of the carbonyl group. Additionally, the compound's structure allows for potential applications in the synthesis of more complex molecules, particularly in the fields of pharmaceuticals and agrochemicals. Its reactivity and functional groups make it a subject of interest for researchers exploring novel synthetic pathways and materials. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H8O3
InChI:InChI=1S/C7H8O3/c1-4-2-5(4)3-6(8)7(9)10/h5H,1-3H2,(H,9,10)
InChI key:InChIKey=IKTGVEIOCJLOFU-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)=O)C1C(=C)C1
Synonyms:- Cyclopropanepropanoic acid, 2-methylene-α-oxo-
- Cyclopropanepyruvic acid, 2-methylene-
- 2-Methylene-α-oxocyclopropanepropanoic acid
- α-Oxo(2-methylenecyclopropyl)propionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ketohypoglycin
CAS:Ketohypoglycin has been utilized to study the inhibition of gluconeogenesis in isolated rat liver cells.Formula:C7H8O3Color and Shape:SolidMolecular weight:140.14
