CAS 5747-46-6

5-bromo-N-{[2-(difluoromethoxy)phenyl]carbamothioyl}-2-methoxybenzamide

Description:

5-bromo-N-{[2-(difluoromethoxy)phenyl]carbamothioyl}-2-methoxybenzamide is a synthetic organic compound characterized by its complex structure, which includes a bromine atom, a difluoromethoxy group, and a carbamothioyl moiety. This compound features a benzamide backbone, which is known for its potential biological activity, particularly in medicinal chemistry. The presence of the bromine atom may enhance its reactivity and influence its pharmacological properties. The difluoromethoxy group contributes to the compound's lipophilicity and may affect its interaction with biological targets. Additionally, the carbamothioyl functional group can impart unique chemical reactivity, making it a candidate for various applications in drug development. The compound's molecular interactions and stability are influenced by its functional groups, which can participate in hydrogen bonding and other intermolecular forces. Overall, this compound's unique combination of elements and functional groups positions it as a subject of interest in research, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₁₆H₁₃BrF₂N₂O₃S

InChI: InChI=1/C16H13BrF2N2O3S/c1-23-12-7-6-9(17)8-10(12)14(22)21-16(25)20-11-4-2-3-5-13(11)24-15(18)19/h2-8,15H,1H3,(H2,20,21,22,25)

SMILES: COc1ccc(cc1C(=NC(=Nc1ccccc1OC(F)F)S)O)Br

Quetiapine EP Impurity T (Quetiapine Morpholine Impurity)

CAS: 5747-46-6

Formula: C₁₇H₁₆N₂OS

Color and Shape: Pale Yellow Solid

Molecular weight: 296.39

Ref: 4Z-Q-0129

11-(Morpholin-4-yl)dibenzo[b,f][1,4]thiazepine

CAS: 5747-46-6

Color and Shape: Neat

Ref: 86-MM1130.28

Quetiapine EP Impurity T

CAS: 5747-46-6

Formula: C₁₇H₁₆N₂OS

Molecular weight: 296.39

Ref: ST-EA-CP-Q1020

11-Morpholino-dibenzo[b,f][1,4]thiazepine

Controlled Product

CAS: 5747-46-6

Applications 11-Morpholino-dibenzo[b,f][1,4]thiazepine is part of a group of 11-(substituted-amino)dibenzo[b,f][1,4]thiazepine compounds that have analgesic and sedative properties.
References Schmutz, J. & Hunziker, F.: Patentschrift (Switz.), 7pp. (1969)

Formula: C₁₇H₁₆N₂OS

Color and Shape: Neat

Molecular weight: 296.39

Ref: TR-M723810

11-Morpholino-dibenzo[b,f][1,4]thiazepine-D8

Controlled Product

CAS: 5747-46-6

Applications 11-Morpholino-dibenzo[b,f][1,4]thiazepine-D8 is a labelled analogue of 11-Morpholino-dibenzo[b,f][1,4]thiazepine (M723810).

Formula: C₁₇D₈H₈N₂OS

Color and Shape: Neat

Molecular weight: 304.436

Ref: TR-M723812