CAS 57471-01-9

1-{3-acetyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl}-1-tert-butylurea

Description:

1-{3-acetyl-4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl}-1-tert-butylurea, with the CAS number 57471-01-9, is a synthetic organic compound characterized by its complex structure, which includes a urea functional group, an acetyl group, and a tert-butyl amino moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical and chemical research. The presence of the hydroxypropoxy group suggests it may engage in hydrogen bonding, influencing its interactions in biological systems. Additionally, the tert-butyl groups contribute to steric hindrance, which can affect the compound's reactivity and stability. Its specific applications may vary, but compounds of this nature are often explored for their potential therapeutic effects or as intermediates in the synthesis of more complex molecules. Overall, the unique combination of functional groups in this compound suggests a diverse range of chemical behavior and potential applications in medicinal chemistry.

Formula: C₂₀H₃₃N₃O₄

InChI: InChI=1/C20H33N3O4/c1-13(24)16-10-14(23(18(21)26)20(5,6)7)8-9-17(16)27-12-15(25)11-22-19(2,3)4/h8-10,15,22,25H,11-12H2,1-7H3,(H2,21,26)

SMILES: CC(=O)c1cc(ccc1OCC(CNC(C)(C)C)O)N(C(=N)O)C(C)(C)C

Celiprolol EP Impurity C

Controlled Product

CAS: 57471-01-9

Formula: C₂₀H₃₃N₃O₄

Color and Shape: Neat

Molecular weight: 379.49

Ref: 86-MM0128.03

N-Didesethyl, N-tertbutyl Celiprolol

Controlled Product

CAS: 57471-01-9

Formula: C₂₀H₃₃N₃O₄

Color and Shape: Neat

Molecular weight: 379.49

Ref: TR-D440805

Celiprolol Hydrochloride EP Impurity C

CAS: 57471-01-9

Formula: C₂₀H₃₃N₃O₄

Molecular weight: 379.5

Ref: ST-EA-CP-C106003