CAS 57473-32-2

5,7-dichloroimidazo[1,2-a]pyrimidine

Description:

5,7-Dichloroimidazo[1,2-a]pyrimidine is a heterocyclic compound characterized by its fused imidazole and pyrimidine rings, which contain chlorine substituents at the 5 and 7 positions. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals, especially in the field of anti-cancer and anti-viral agents. The presence of chlorine atoms enhances its lipophilicity and may influence its interaction with biological targets. Additionally, 5,7-dichloroimidazo[1,2-a]pyrimidine is soluble in organic solvents, which can facilitate its use in various chemical reactions and formulations. Its molecular structure allows for diverse reactivity, making it a valuable compound in synthetic organic chemistry. As with many heterocycles, it may also exhibit interesting electronic properties, contributing to its potential applications in materials science and drug design.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-4-3-5(8)11-2-1-9-6(11)10-4/h1-3H

SMILES: c1cn2c(cc(Cl)nc2n1)Cl

Synonyms:

• Imidazo[1,2-A]Pyrimidine, 5,7-Dichloro-

5,7-DICHLORO-IMIDAZO[1,2-A]PYRIMIDINE

CAS: 57473-32-2

Formula: C₆H₃Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA00EDCF

5,7-Dichloroimidazo[1,2-a]pyrimidine

CAS: 57473-32-2

5,7-Dichloroimidazo[1,2-a]pyrimidine

Purity: 97%

Molecular weight: 188.01g/mol

Ref: 54-OR78308

5,7-Dichloroimidazo[1,2-a]pyrimidine

CAS: 57473-32-2

Formula: C₆H₃Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.01

Ref: 10-F223344

5,7-Dichloroimidazo[1,2-a]pyrimidine

Controlled Product

CAS: 57473-32-2

Applications 5,7-Dichloroimidazo[1,2-a]pyrimidine (cas# 57473-32-2) is a compound useful in organic synthesis.

Formula: C₆H₃Cl₂N₃

Color and Shape: Neat

Molecular weight: 188.01

Ref: TR-D434840