CAS 574758-53-5

6-Hydroxy-1H-indazole-5-carboxylic acid

Description:

6-Hydroxy-1H-indazole-5-carboxylic acid, with the CAS number 574758-53-5, is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a hydroxyl group at the 6-position and a carboxylic acid group at the 5-position contributes to its polar nature, making it soluble in polar solvents. This compound is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and analgesic properties. Its structural features allow for various interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound may exhibit tautomeric forms due to the presence of the hydroxyl and carboxylic acid functional groups, influencing its reactivity and stability. Overall, 6-Hydroxy-1H-indazole-5-carboxylic acid represents a valuable scaffold for further chemical modifications and investigations in drug development.

Formula: C₈H₆N₂O₃

InChI: InChI=1S/C8H6N2O3/c11-7-2-6-4(3-9-10-6)1-5(7)8(12)13/h1-3,11H,(H,9,10)(H,12,13)

SMILES: c1c2cn[nH]c2cc(c1C(=O)O)O

Synonyms:

• 1H-Indazole-5-carboxylic acid, 6-hydroxy-

1H-​Indazole-​5-​carboxylic acid, 6-​hydroxy-

CAS: 574758-53-5

Formula: C₈H₆N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.1448

Ref: IN-DA00F2OF

6-Hydroxy-1H-indazole-5-carboxylic acid

CAS: 574758-53-5

6-Hydroxy-1H-indazole-5-carboxylic acid

Purity: 95%

Molecular weight: 178.14g/mol

Ref: 54-OR305127

6-HYDROXY-1H-INDAZOLE-5-CARBOXYLIC ACID

CAS: 574758-53-5

Formula: C₈H₆N₂O₃

Purity: 95.0%

Molecular weight: 178.147

Ref: 10-F501481

6-Hydroxy-1H-indazole-5-carboxylic acid

CAS: 574758-53-5

Versatile small molecule scaffold

Formula: C₈H₆N₂O₃

Purity: Min. 95%

Molecular weight: 178.14 g/mol

Ref: 3D-ZXA75853