CymitQuimica logo

CAS 57476-50-3

:

tert-butyl 3-formyl-1H-indole-1-carboxylate

Description:
Tert-butyl 3-formyl-1H-indole-1-carboxylate, with the CAS number 57476-50-3, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a tert-butyl ester group, which enhances its lipophilicity and stability. The presence of a formyl group (-CHO) at the 3-position of the indole ring indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The carboxylate moiety contributes to its reactivity and potential applications in organic synthesis. Typically, compounds like this are of interest in medicinal chemistry and material science due to their biological activity and ability to serve as intermediates in the synthesis of more complex molecules. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, tert-butyl 3-formyl-1H-indole-1-carboxylate is a versatile compound with potential applications in various fields of chemistry.
Formula:C14H15NO3
InChI:InChI=1/C14H15NO3/c1-14(2,3)18-13(17)15-8-10(9-16)11-6-4-5-7-12(11)15/h4-9H,1-3H3
InChI key:GDYHUGFAKMUUQL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)n1cc(C=O)c2ccccc12
Synonyms:
  • 1H-indole-1-carboxylic acid, 3-formyl-, 1,1-dimethylethyl ester
  • tert-Butyl 3-formyl-1H-indole-1-carboxylate
Found 5 products.