CAS 5748-36-7

3'-chlorobiphenyl-4-amine

Description:

3'-Chlorobiphenyl-4-amine, with the CAS number 5748-36-7, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 3' position of one phenyl ring and an amino group (-NH2) at the 4-position of the other ring contributes to its chemical properties. This compound is typically a solid at room temperature and is known for its potential applications in various fields, including organic synthesis and materials science. It may exhibit moderate solubility in organic solvents, while its solubility in water is generally low due to the hydrophobic nature of the biphenyl structure. The chlorine substituent can influence the compound's reactivity and stability, making it of interest in studies related to environmental chemistry and toxicology. As with many chlorinated compounds, it is essential to handle 3'-chlorobiphenyl-4-amine with care due to potential health and environmental risks associated with chlorinated aromatic compounds.

Formula: C₁₂H₁₀ClN

InChI: InChI=1/C12H10ClN/c13-11-3-1-2-10(8-11)9-4-6-12(14)7-5-9/h1-8H,14H2

SMILES: c1cc(cc(c1)Cl)c1ccc(cc1)N

Synonyms:

• [1,1'-Biphenyl]-4-Amine, 3'-Chloro-

3'-Chloro-[1,1'-biphenyl]-4-amine

CAS: 5748-36-7

3'-Chloro-[1,1'-biphenyl]-4-amine

Purity: ≥95%

Molecular weight: 203.67g/mol

Ref: 54-OR7341

(3′-chlorobiphenyl-4-yl)amine

CAS: 5748-36-7

Formula: C₁₂H₁₀ClN

Purity: 95.0%

Molecular weight: 203.67

Ref: 10-F313614