CymitQuimica logo

CAS 5748-42-5

:

Butylphenylbenzoicacid

Description:
Butylphenylbenzoic acid, with the CAS number 5748-42-5, is an organic compound characterized by its structure, which includes a butyl group, a phenyl group, and a benzoic acid moiety. This compound typically appears as a solid at room temperature and is known for its relatively low solubility in water, while being more soluble in organic solvents. It exhibits properties typical of carboxylic acids, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. Butylphenylbenzoic acid may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of certain materials. Its chemical stability and functional groups allow it to participate in various chemical reactions, making it a versatile compound in both industrial and research settings. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C17H18O2
InChI:InChI=1/C17H18O2/c1-17(2,3)15-10-8-13(9-11-15)12-4-6-14(7-5-12)16(18)19/h4-11H,1-3H3,(H,18,19)
InChI key:HZIOPONJCVOCFE-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(cc1)c1ccc(cc1)C(=O)O
Synonyms:
  • 4-(4-tert-Butylphenyl)benzoic acid
  • 4'-Tert-Butylbiphenyl-4-Carboxylic Acid
Found 5 products.