CAS 5748-43-6

2'-methylbiphenyl-4-carboxylate

Description:

2'-Methylbiphenyl-4-carboxylate, with the CAS number 5748-43-6, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the 2' position and a carboxylate group at the 4 position contributes to its chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It exhibits moderate stability under standard conditions but may undergo reactions typical of carboxylate esters, such as hydrolysis in the presence of strong acids or bases. Its derivatives and related compounds are often studied for applications in organic synthesis, pharmaceuticals, and materials science due to their potential biological activity and utility in various chemical reactions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₄H₁₁O₂

InChI: InChI=1/C14H12O2/c1-10-4-2-3-5-13(10)11-6-8-12(9-7-11)14(15)16/h2-9H,1H3,(H,15,16)/p-1

SMILES: Cc1ccccc1c1ccc(cc1)C(=O)[O-]

4-(2-Methylphenyl)benzoic acid

CAS: 5748-43-6

Formula: C₁₄H₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.2439

Ref: IN-DA00EBPF

2'-Methyl-[1,1'-biphenyl]-4-carboxylic acid

CAS: 5748-43-6

2'-Methyl-[1,1'-biphenyl]-4-carboxylic acid

Purity: ≥95%

Color and Shape: Pale Pink Solid

Molecular weight: 212.24g/mol

Ref: 54-OR7515

2′-Methylbiphenyl-4-carboxylic acid

CAS: 5748-43-6

Formula: C₁₄H₁₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 212.248

Ref: 10-F014240