CymitQuimica logo

CAS 57489-77-7

:

5,7-Dichloropyrazolo[1,5-a]pyrimidine

Description:
5,7-Dichloropyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contain two chlorine substituents at the 5 and 7 positions. This compound typically exhibits a crystalline solid form and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of chlorine atoms enhances its lipophilicity and may influence its interaction with biological targets. It is often utilized in research related to pharmacology, particularly in the development of compounds that can modulate various biological pathways. The molecular structure contributes to its reactivity and stability, and it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data sheets should be consulted for handling and toxicity information, as with many chemical substances, proper precautions are necessary when working with this compound. Overall, 5,7-Dichloropyrazolo[1,5-a]pyrimidine represents a significant class of compounds with diverse applications in chemical and pharmaceutical research.
Formula:C6H3Cl2N3
InChI:InChI=1/C6H3Cl2N3/c7-4-3-5(8)11-6(10-4)1-2-9-11/h1-3H
InChI key:JMTFWCYVZOFHLR-UHFFFAOYSA-N
SMILES:c1cnn2c(cc(Cl)nc12)Cl
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine, 5,7-dichloro-
Found 6 products.