CAS 57489-79-9

pyrazolo[1,5-a]pyrimidin-7(1H)-one

Description:

Pyrazolo[1,5-a]pyrimidin-7(1H)-one is a heterocyclic organic compound characterized by a fused ring system that includes both pyrazole and pyrimidine moieties. This compound typically exhibits a planar structure due to the conjugated system of double bonds, which can contribute to its stability and reactivity. It is often recognized for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the carbonyl group at the 7-position enhances its ability to participate in various chemical reactions, such as nucleophilic attacks. Additionally, pyrazolo[1,5-a]pyrimidin-7(1H)-one may exhibit properties such as solubility in polar solvents, which can vary based on the specific substituents attached to the core structure. Its unique arrangement of nitrogen and carbon atoms allows for diverse interactions with biological targets, potentially leading to applications in treating various diseases. Overall, this compound represents a significant class of heterocycles with promising pharmacological properties.

Formula: C₆H₅N₃O

InChI: InChI=1/C6H5N3O/c10-6-2-3-7-5-1-4-8-9(5)6/h1-4,8H

SMILES: c1c[nH]n2c1nccc2=O

Pyrazolo[1,5-a]pyrimidin-7-ol

CAS: 57489-79-9

Formula: C₆H₅N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 135.1234

Ref: IN-DA00EKBM

Pyrazolo[1,5-a]pyrimidin-7-ol

CAS: 57489-79-9

Pyrazolo[1,5-a]pyrimidin-7-ol

Purity: 98%

Molecular weight: 135.12g/mol

Ref: 54-OR82568

Pyrazolo[1,5-a]pyrimidin-7-ol

CAS: 57489-79-9

Purity: 98%

Molecular weight: 135.04

Ref: 10-F552213

Pyrazolo[1,5-a]pyrimidin-7(1H)-one

CAS: 57489-79-9

Pyrazolo[1,5-a]pyrimidin-7(1H)-one (PPY) is a natural product that has been shown to be active against tuberculosis in humans. PPY inhibits the activity of fatty acid synthase and cyclooxygenase, which are enzymes that play a role in the biosynthesis of prostaglandin E2. PPY also inhibits the proliferation of ovary cells and increases hyperactivity in mammalian cells. It has been shown to have antidepressant effects and may be used for treatment of depression.

Formula: C₆H₅N₃O

Purity: Min. 95%

Molecular weight: 135.12 g/mol

Ref: 3D-HCA48979