CAS 57491-33-5
:(E)-hexadec-11-enal
Description:
(E)-hexadec-11-enal, also known as (E)-11-hexadecenal, is an unsaturated aldehyde characterized by a long carbon chain with a double bond located at the 11th carbon from the aldehyde functional group. Its molecular formula is C16H30O, indicating it consists of 16 carbon atoms, 30 hydrogen atoms, and one oxygen atom. The presence of the double bond contributes to its reactivity, making it susceptible to various chemical reactions such as oxidation and polymerization. This compound typically appears as a colorless to pale yellow liquid with a fatty, waxy odor, which is common among long-chain aldehydes. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. (E)-hexadec-11-enal is of interest in various fields, including fragrance and flavor industries, as well as in organic synthesis, where it can serve as a building block for more complex molecules. Its structural characteristics and reactivity make it a valuable compound in both industrial and research applications.
Formula:C16H30O
InChI:InChI=1/C16H30O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h5-6,16H,2-4,7-15H2,1H3/b6-5+
InChI key:InChIKey=AMTITFMUKRZZEE-AATRIKPKSA-N
SMILES:C(CC/C=C/CCCC)CCCCCCC=O
Synonyms:- (11E)-11-Hexadecenal
- (11E)-hexadec-11-enal
- (E)-11-Hexacenal
- (E)-11-Hexadecenal
- 11-Hexadecenal, (11E)-
- 11-Hexadecenal, (E)-
- Ai3-36726
- (E)-Hexadec-11-enal
- Einecs 260-765-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(11E)-11-Hexadecenal
CAS:Controlled ProductFormula:C16H30OColor and Shape:NeatMolecular weight:238.409
