CAS 57498-96-1

5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one

Description:

5-Hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one, with the CAS number 57498-96-1, is a synthetic compound that belongs to the class of flavonoids, specifically a type of chromone. This compound features a complex polycyclic structure that includes a pyran and chromone moiety, contributing to its potential biological activities. It is characterized by the presence of multiple hydroxyl groups, which enhance its solubility and reactivity, as well as its ability to act as an antioxidant. The compound may exhibit various pharmacological properties, including anti-inflammatory and anticancer activities, making it of interest in medicinal chemistry and natural product research. Its structural features suggest that it could interact with biological systems through mechanisms such as enzyme inhibition or modulation of signaling pathways. However, detailed studies are necessary to fully elucidate its biological effects and potential applications in therapeutics.

Formula: C₂₀H₁₆O₅

InChI: InChI=1/C20H16O5/c1-20(2)8-7-13-16(25-20)10-17-18(19(13)23)14(22)9-15(24-17)11-3-5-12(21)6-4-11/h3-10,21,23H,1-2H3

SMILES: CC1(C)C=Cc2c(cc3c(c(=O)cc(c4ccc(cc4)O)o3)c2O)O1

Synonyms:

• 2H,6H-benzo[1,2-b:5,4-b']dipyran-6-one, 5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-

Carpachromene

CAS: 57498-96-1

Formula: C₂₀H₁₆O₅

Molecular weight: 336.34

Ref: 7W-GL7754

Carpachromene

CAS: 57498-96-1

Carpachromene is a bioactive compound, which is a derivative of coumarin, a naturally occurring aromatic organic chemical compound. It is sourced primarily from plants, particularly those within the Apiaceae family, which are known for their medicinal properties. Carpachromene exhibits its mode of action through interactions with various biological pathways, including anti-inflammatory and antioxidant mechanisms. These interactions are achieved by modulating enzyme activities and interfering with inflammatory cytokine production, which makes it a potential candidate for therapeutic applications.

Formula: C₂₀H₁₆O₅

Purity: Min. 95%

Molecular weight: 336.3 g/mol

Ref: 3D-HCA49896