CAS 57499-59-9

2,8-Dihydroxy-3,7-dimethoxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione

Description:

2,8-Dihydroxy-3,7-dimethoxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, with the CAS number 57499-59-9, is a complex organic compound characterized by its polycyclic structure, which includes multiple aromatic rings and functional groups. This compound features two hydroxyl (-OH) groups and two methoxy (-OCH3) groups, contributing to its potential reactivity and solubility properties. The presence of the dione functional groups indicates that it can participate in various chemical reactions, including oxidation and reduction processes. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry and natural product research. The compound's solubility is likely influenced by the balance of hydrophilic and hydrophobic regions within its molecular framework. Additionally, its stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 2,8-Dihydroxy-3,7-dimethoxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione represents a fascinating subject for further study in both synthetic and applied chemistry contexts.

Formula: C₁₆H₁₀O₈

InChI: InChI=1S/C16H10O8/c1-21-8-4-6-9-10-5(15(19)23-13(9)11(8)18)3-7(17)12(22-2)14(10)24-16(6)20/h3-4,17-18H,1-2H3

InChI key: InChIKey=SUBZWRYOAOVYOC-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C3C=4C(=CC(OC)=C(O)C4OC(=O)C3=CC1O)C(=O)O2

Synonyms:

• 3,4′-Di-O-methylellagic acid
• 2,8-Dihydroxy-3,7-dimethoxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione
• 3,4′-O-Dimethylellagic acid
• [1]Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 2,8-dihydroxy-3,7-dimethoxy-

3,4'-Di-O-methylellagic acid

CAS: 57499-59-9

Formula: C₁₆H₁₀O₈

Purity: 95%~99%

Molecular weight: 330.248

Ref: BP-BP4758

3,4’-O-dimethylellagic acid

CAS: 57499-59-9

3,4’-O-dimethylellagic acid is a phenolic compound, which is a type of ellagic acid derivative. It is derived from natural sources, typically found in various fruits, nuts, and vegetables, particularly in certain berries and pomegranates. The compound is formed through the methylation of ellagic acid, which amplifies its lipophilicity and enhances its bioavailability.

Purity: Min. 95%

Ref: 3D-FD74035