CAS 575-68-8: 1-Propanone, 1-(4-fluoro-2-methylphenyl)-

Description:1-Propanone, 1-(4-fluoro-2-methylphenyl)-, also known as 4-Fluoro-2-methylacetophenone, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. It features a propanone backbone with a phenyl group that has a fluorine atom and a methyl group at specific positions on the ring. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic aromatic structure. The presence of the fluorine atom can influence its reactivity and physical properties, such as increasing its lipophilicity and potentially enhancing its biological activity. 1-Propanone, 1-(4-fluoro-2-methylphenyl)- is used in various applications, including as an intermediate in organic synthesis and in the production of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.

Formula:C₁₀H₁₁FO

InChI:InChI=1S/C10H11FO/c1-3-10(12)9-5-4-8(11)6-7(9)2/h4-6H,3H2,1-2H3

InChI key:InChIKey=TWYMZOGXZKHSGS-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(F)C=C1C)CC