CAS 575-81-5
:Synephrine
Description:
Synephrine is a naturally occurring alkaloid primarily found in bitter orange (Citrus aurantium) and other citrus fruits. It is structurally similar to ephedrine and is classified as a sympathomimetic amine, which means it can mimic the effects of the sympathetic nervous system. Synephrine is often marketed as a dietary supplement for weight loss and energy enhancement due to its potential to increase metabolic rate and promote fat oxidation. It is known to act primarily as an alpha-1 adrenergic receptor agonist, leading to vasoconstriction and increased blood pressure, while also exhibiting some beta-adrenergic activity. Synephrine is typically available in various forms, including powders and capsules, and is often included in pre-workout and fat-burning supplements. While it is generally considered safe in moderate doses, excessive consumption can lead to side effects such as increased heart rate, hypertension, and anxiety. As with any supplement, it is advisable to consult a healthcare professional before use, especially for individuals with pre-existing health conditions.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1
SMILES:CNC[C@@H](c1ccc(cc1)O)O
Synonyms:- 4-(1-Hydroxy-2-(Methylamino)Ethyl)Phenol
- 4-Hydroxy-alpha-(methylaminomethyl)benzyl
- 2-[1-Hydroxy-2-(Methylamino)Ethyl]Phenol
- 4-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenol
- 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol
- Immature bitter orange extract
- Citrus aurantium extract
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Epinephrine Impurity 85 HCl
CAS:Formula:C9H13NO2·HClColor and Shape:White To Off-White SolidMolecular weight:167.21 36.46
