CAS 5750-74-3

N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]thiophene-2-carboxamide

Description:

N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]thiophene-2-carboxamide, with the CAS number 5750-74-3, is a chemical compound characterized by its complex structure, which includes a thiophene ring, a benzoxazole moiety, and an amide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the chloro substituent on the benzoxazole ring may influence its electronic properties and reactivity. Additionally, the thiophene ring contributes to the compound's aromatic character and may enhance its interactions with biological targets. The amide group is known for its ability to form hydrogen bonds, which can play a crucial role in the compound's biological activity and stability. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₈H₁₁ClN₂O₂S

InChI: InChI=1/C18H11ClN2O2S/c19-12-5-8-15-14(10-12)21-18(23-15)11-3-6-13(7-4-11)20-17(22)16-2-1-9-24-16/h1-10H,(H,20,22)

SMILES: c1cc(C(=Nc2ccc(cc2)c2nc3cc(ccc3o2)Cl)O)sc1

Synonyms:

• 2-thiophenecarboxamide, N-[4-(5-chloro-2-benzoxazolyl)phenyl]-
• 2,5-dichloro-4-methoxypyrimidine

2,5-Dichloro-4-methoxypyrimidine

CAS: 5750-74-3

Formula: C₅H₄Cl₂N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 179.0041

Ref: IN-DA00EDA9

2,5-Dichloro-4-methoxypyrimidine

CAS: 5750-74-3

Purity: 98%

Molecular weight: 179.004

Ref: FT-D10990

2,5-Dichloro-4-methoxypyrimidine

CAS: 5750-74-3

2,5-Dichloro-4-methoxypyrimidine

Purity: 97%

Molecular weight: 179.00g/mol

Ref: 54-OR932533

2,5-Dichloro-4-methoxypyrimidine

CAS: 5750-74-3

Formula: C₅H₄Cl₂N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 179

Ref: 10-F229765