CAS 57500-07-9
:6-Benzyloxypurine
Description:
6-Benzyloxypurine is a purine derivative characterized by the presence of a benzyl ether group at the 6-position of the purine ring. This compound is typically a white to off-white solid and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but has limited solubility in water. It exhibits properties typical of purine analogs, including potential biological activity, which may include effects on nucleic acid metabolism and cellular signaling pathways. The compound is of interest in medicinal chemistry and biochemistry due to its structural similarity to natural purines, which may allow it to interact with various biological targets. Additionally, 6-Benzyloxypurine can serve as a useful intermediate in the synthesis of other bioactive molecules. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C12H10N4O
InChI:InChI=1/C12H10N4O/c1-2-4-9(5-3-1)6-17-12-10-11(14-7-13-10)15-8-16-12/h1-5,7-8H,6H2,(H,13,14,15,16)
SMILES:c1ccc(cc1)COc1c2c([nH]cn2)ncn1
Synonyms:- 6-(benzyloxy)-5H-purine
- 6-(benzyloxy)-7H-purine
- 6-Benzyloxy purine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Benzyloxypurine
CAS:Formula:C12H10N4OPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:226.246-(Benzyloxy)-9H-purine
CAS:Formula:C12H10N4OPurity:98%Color and Shape:SolidMolecular weight:226.23406-Benzyloxypurine
CAS:6-Benzyloxypurine is a fluorescent compound that can be used to measure the concentration of aqueous solutions. It is used in molecular modeling and as a tracer in bioassays. The binding constants for 6-benzyloxypurine have been determined by fluorescence spectrometry, and it has been shown to inhibit the growth of aerobacter aerogenes at concentrations greater than 0.5 mM. This inhibitor also has an inhibitory effect on the growth of tissue culture cells and wastewater treatment bacteria, such as enterococcus faecalis and pseudomonas aeruginosa. The optimum concentration of 6-benzyloxypurine to inhibit bacterial growth is 1 mM, which corresponds to a pH of ~8.2.
Formula:C12H10N4OPurity:Min. 95%Molecular weight:226.23 g/mol





