CAS 57520-17-9
:Iminoctadine triacetate
Description:
Iminoctadine triacetate, with the CAS number 57520-17-9, is a chemical compound primarily used in agricultural applications, particularly as a plant growth regulator and fungicide. It is characterized by its ability to enhance plant growth and improve resistance to various pathogens. The compound is a derivative of imino compounds and features three acetate groups, which contribute to its solubility and bioactivity. Iminoctadine triacetate is known for its low toxicity to humans and animals, making it a safer alternative in crop protection. Its mode of action typically involves the modulation of plant hormonal pathways, leading to improved growth and development. Additionally, it is often employed in integrated pest management systems due to its effectiveness and environmental compatibility. As with any chemical substance, proper handling and adherence to safety guidelines are essential to minimize any potential risks associated with its use.
Formula:C18H41N7·3C2H4O2
InChI:InChI=1S/C18H41N7.C2H4O2/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22;1-2(3)4/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25);1H3,(H,3,4)
InChI key:InChIKey=IGAGEWSIVSNYJF-UHFFFAOYSA-N
SMILES:C(NC(=N)N)CCCCCCCNCCCCCCCCNC(=N)N.C(C)(O)=O
Synonyms:- DF 125
- guanidine, acetate (1:3)
- SN 513
- 1,17-Diguanidino-9-azaheptadecane triacetate
- Guanidine, N,N′′′-(iminodi-8,1-octanediyl)bis-, triacetate
- Guanidine, N,N′′′-(iminodi-8,1-octanediyl)bis-, acetate (1:3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Iminoctadine triacetate
CAS:Controlled ProductFormula:C18H41N7C2H4O2Color and Shape:NeatMolecular weight:535.72Iminoctadine Triacetate
CAS:Controlled ProductFormula:C18H41N7·3C2H4O2Color and Shape:NeatMolecular weight:535.72

