CAS 57520-17-9

Iminoctadine triacetate

Description:

Iminoctadine triacetate, with the CAS number 57520-17-9, is a chemical compound primarily used in agricultural applications, particularly as a plant growth regulator and fungicide. It is characterized by its ability to enhance plant growth and improve resistance to various pathogens. The compound is a derivative of imino compounds and features three acetate groups, which contribute to its solubility and bioactivity. Iminoctadine triacetate is known for its low toxicity to humans and animals, making it a safer alternative in crop protection. Its mode of action typically involves the modulation of plant hormonal pathways, leading to improved growth and development. Additionally, it is often employed in integrated pest management systems due to its effectiveness and environmental compatibility. As with any chemical substance, proper handling and adherence to safety guidelines are essential to minimize any potential risks associated with its use.

Formula: C₁₈H₄₁N₇·3C₂H₄O₂

InChI: InChI=1S/C18H41N7.C2H4O2/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22;1-2(3)4/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25);1H3,(H,3,4)

InChI key: InChIKey=IGAGEWSIVSNYJF-UHFFFAOYSA-N

SMILES: C(NC(=N)N)CCCCCCCNCCCCCCCCNC(=N)N.C(C)(O)=O

Synonyms:

• DF 125
• guanidine, acetate (1:3)
• SN 513
• 1,17-Diguanidino-9-azaheptadecane triacetate
• Guanidine, N,N′′′-(iminodi-8,1-octanediyl)bis-, triacetate
• Guanidine, N,N′′′-(iminodi-8,1-octanediyl)bis-, acetate (1:3)

Iminoctadine triacetate

Controlled Product

CAS: 57520-17-9

Formula: C₁₈H₄₁N₇C₂H₄O₂

Color and Shape: Colourless Crystalline

Molecular weight: 535.72

Ref: 04-C14284900

Iminoctadine Triacetate

Controlled Product

CAS: 57520-17-9

Formula: C₁₈H₄₁N₇·3C₂H₄O₂

Color and Shape: Neat

Molecular weight: 535.72

Ref: TR-I400053