CAS 57530-40-2: ethyl [10-(N,N-diethyl-beta-alanyl)-10H-phenothiazin-2-yl]carbamate hydrochloride
Description:Ethyl [10-(N,N-diethyl-beta-alanyl)-10H-phenothiazin-2-yl]carbamate hydrochloride, with the CAS number 57530-40-2, is a chemical compound that belongs to the phenothiazine class, which is known for its diverse pharmacological properties. This substance typically exhibits characteristics such as being a white to off-white crystalline powder, soluble in water and organic solvents, which is common for many carbamate derivatives. Its structure features a phenothiazine core, which contributes to its potential biological activity, particularly in the realm of neuropharmacology. The presence of the diethyl-beta-alanyl group suggests that it may interact with neurotransmitter systems, possibly influencing mood or behavior. As a hydrochloride salt, it is likely to have enhanced stability and solubility compared to its free base form. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C22H28ClN3O3S
InChI:InChI=1/C22H27N3O3S.ClH/c1-4-24(5-2)14-13-21(26)25-17-9-7-8-10-19(17)29-20-12-11-16(15-18(20)25)23-22(27)28-6-3;/h7-12,15H,4-6,13-14H2,1-3H3,(H,23,27);1H
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethacizine hydrochloride REF: 54-BUP21852CAS: 57530-40-2 | ≥98% | 319.00 € | Fri 03 Oct 25 |
![]() | Ethacizine hydrochloride REF: TM-T11239CAS: 57530-40-2 | 98.08% - 98.08% | 226.00 € | Tue 07 Oct 25 |

Ethacizine hydrochloride
Ref: TM-T11239
1mg | 226.00 € |