CymitQuimica logo

CAS 57531-87-0

:

2,4,5-trichloro-6-methoxybenzene-1,3-dicarbonitrile

Description:
2,4,5-Trichloro-6-methoxybenzene-1,3-dicarbonitrile, with the CAS number 57531-87-0, is an organic compound characterized by its complex structure featuring multiple functional groups. It contains a benzene ring substituted with three chlorine atoms and a methoxy group, along with two cyano groups (–C≡N) at the 1 and 3 positions of the ring. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms contributes to its potential reactivity and environmental persistence, while the cyano groups can impart significant biological activity. As a dicarbonitrile, it may be involved in various chemical reactions, including nucleophilic additions and substitutions. Its applications can span across fields such as agrochemicals, pharmaceuticals, and materials science, although specific uses may vary based on regulatory considerations and safety profiles. Proper handling and disposal are essential due to the potential toxicity associated with halogenated compounds.
Formula:C9H3Cl3N2O
InChI:InChI=1/C9H3Cl3N2O/c1-15-9-5(3-14)6(10)4(2-13)7(11)8(9)12/h1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.