CAS 5754-34-7: 4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
Description:4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane, with the CAS number 5754-34-7, is an organic compound characterized by its dioxolane ring structure, which includes two ether linkages and a hydroxyl group. This compound is typically a colorless to pale yellow liquid with a mild odor. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydroxyethyl group enhances its hydrophilicity, while the dimethyl substitution contributes to its stability and potential use as a solvent or reagent in chemical synthesis. Additionally, this compound may exhibit properties such as low volatility and moderate viscosity, which can be advantageous in formulations. Its chemical stability and reactivity can be influenced by the functional groups present, allowing it to participate in various chemical reactions, including esterification and etherification. Overall, 4-(2-Hydroxyethyl)-2,2-dimethyl-1,3-dioxolane is of interest in both industrial and research settings, particularly in the fields of organic chemistry and materials science.
Formula:C27H28ClNO5
InChI:InChI=1/C27H28ClNO5/c1-5-34-27(31)24-15(2)29-20-12-18(16-6-9-19(28)10-7-16)13-21(30)26(20)25(24)17-8-11-22(32-3)23(14-17)33-4/h6-11,14,18,25,29H,5,12-13H2,1-4H3
- Synonyms:
- (Rac)-2-(2,2-Dimethyl[1,3]Dioxolane-4Yl)Ethanol
- Ethyl 7-(4-Chlorophenyl)-4-(3,4-Dimethoxyphenyl)-2-Methyl-5-Oxo-1,4,5,6,7,8-Hexahydroquinoline-3-Carboxylate
- 1,3-Dioxolane-4-ethanol, 2,2-dimethyl-