CAS 57543-37-0
:6-Bromo-2H-1-benzopyran-3-carboxaldehyde
Description:
6-Bromo-2H-1-benzopyran-3-carboxaldehyde is a chemical compound characterized by its unique structure, which includes a benzopyran moiety with a bromine substituent and an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The aldehyde group is reactive, allowing for further functionalization and derivatization. This compound may also display biological activity, which is of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and conditions used, and it is important to handle it with care due to potential toxicity associated with brominated compounds. Overall, 6-Bromo-2H-1-benzopyran-3-carboxaldehyde serves as a valuable building block in synthetic organic chemistry and may have applications in the development of pharmaceuticals and agrochemicals.
Formula:C10H7BrO2
InChI:InChI=1S/C10H7BrO2/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-5H,6H2
InChI key:InChIKey=UMACKWGLPRYSPV-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=2C(OC1)=CC=C(Br)C2
Synonyms:- 2H-1-benzopyran-3-carboxaldehyde, 6-bromo-
- 6-Bromo-2H-1-benzopyran-3-carboxaldehyde
- 6-Bromo-2H-chromene-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
