CymitQuimica logo

CAS 575474-23-6

:

methyl 5-amino-2-(trifluoromethyl)benzoate

Description:
Methyl 5-amino-2-(trifluoromethyl)benzoate, identified by its CAS number 575474-23-6, is an organic compound that features a benzoate structure with a methyl ester functional group. This compound is characterized by the presence of an amino group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The amino group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents, while the trifluoromethyl group is known for its electron-withdrawing properties, which can affect the acidity and reactivity of adjacent functional groups. Methyl 5-amino-2-(trifluoromethyl)benzoate may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its unique combination of functional groups makes it a subject of interest in synthetic organic chemistry, particularly in the development of new compounds with specific biological or chemical properties. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C9H8F3NO2
InChI:InChI=1S/C9H8F3NO2/c1-15-8(14)6-4-5(13)2-3-7(6)9(10,11)12/h2-4H,13H2,1H3
InChI key:DXTOMFQTBDTTFG-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=CC(=C1)N)C(F)(F)F
Found 4 products.