CAS 5755-62-4

N-(4-methoxyphenyl)-6-methyl-2-thioxo-4-(2,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxamide

Description:

N-(4-methoxyphenyl)-6-methyl-2-thioxo-4-(2,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxamide, with CAS number 5755-62-4, is a chemical compound characterized by its complex structure, which includes a tetrahydropyrimidine core, thioxo group, and multiple methoxy substituents on aromatic rings. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, including antimicrobial or anticancer effects, due to its structural features that may interact with biological targets. The presence of methoxy groups can enhance lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the thioxo group may contribute to its reactivity and stability. The compound's synthesis often involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity. Overall, this compound represents a class of organic molecules that may have significant pharmacological implications, warranting further investigation into its biological activities and potential applications.

Formula: C₂₂H₂₅N₃O₅S

InChI: InChI=1/C22H25N3O5S/c1-12-19(21(26)24-13-6-8-14(27-2)9-7-13)20(25-22(31)23-12)15-10-17(29-4)18(30-5)11-16(15)28-3/h6-11,20H,1-5H3,(H,24,26)(H2,23,25,31)

SMILES: CC1=C(C(c2cc(c(cc2OC)OC)OC)NC(=N1)S)C(=O)Nc1ccc(cc1)OC

2-[(2-Bromoethyl)sulfanyl]propane

CAS: 5755-62-4

Versatile small molecule scaffold

Formula: C₂₂H₂₅N₃O₅S

Purity: Min. 95%

Molecular weight: 443.5 g/mol

Ref: 3D-FAA75562