CAS 5755-77-1

1-((3-Bromopropyl)sulfonyl)-4-methylbenzene

Description:

1-((3-Bromopropyl)sulfonyl)-4-methylbenzene, also known by its CAS number 5755-77-1, is an organic compound characterized by the presence of a sulfonyl group attached to a 4-methylbenzene ring, along with a 3-bromopropyl substituent. This compound features a sulfonyl functional group, which is known for its strong electron-withdrawing properties, enhancing the reactivity of the molecule. The bromopropyl group introduces a halogen, which can participate in various chemical reactions, such as nucleophilic substitutions. The methyl group on the benzene ring contributes to the compound's hydrophobic character and can influence its solubility in organic solvents. The overall structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of both bromine and sulfonyl groups may impart unique properties, such as increased polarity and reactivity, making it a valuable intermediate in chemical reactions. Safety and handling precautions should be observed due to the potential hazards associated with brominated compounds.

Formula: C₁₀H₁₃BrO₂S

InChI: InChI=1S/C10H13BrO2S/c1-9-3-5-10(6-4-9)14(12,13)8-2-7-11/h3-6H,2,7-8H2,1H3

InChI key: InChIKey=ZOEACTLFFZEVMD-UHFFFAOYSA-N

SMILES: S(CCCBr)(=O)(=O)C1=CC=C(C)C=C1

1-(3-Bromopropanesulfonyl)-4-methylbenzene

CAS: 5755-77-1

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrO₂S

Purity: Min. 95%

Molecular weight: 277.18 g/mol

Ref: 3D-FAA75577