CAS 57568-63-5
:9-Bromo-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one
Description:
9-Bromo-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one is a heterocyclic organic compound characterized by its complex fused ring structure, which includes both aromatic and thiophene components. The presence of a bromine atom at the 9-position contributes to its reactivity and potential applications in organic synthesis and materials science. This compound typically exhibits properties associated with aromatic systems, such as stability and distinct electronic characteristics, which can influence its behavior in chemical reactions. It may also display interesting photophysical properties due to its conjugated system. The compound's molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as a building block in organic electronics. Its CAS number, 57568-63-5, allows for easy identification and retrieval of information in chemical databases. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns associated with halogenated organic substances.
Formula:C13H7BrOS
InChI:InChI=1S/C13H7BrOS/c14-11-7-12-10(5-6-16-12)13(15)9-4-2-1-3-8(9)11/h1-7H
InChI key:InChIKey=YKBOOMSHWREKCW-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(Br)=CC3=C1C=CS3)=CC=CC2
Synonyms:- 9-Bromo-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one
- 4H-Benzo[4,5]cyclohepta[1,2-b]thiophen-4-one, 9-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
