CAS 57576-41-7

1,2-dimethoxy-4H-dibenzo[de,g]quinoline-4,5(6H)-dione

Description:

1,2-Dimethoxy-4H-dibenzo[de,g]quinoline-4,5(6H)-dione, with the CAS number 57576-41-7, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a quinoline core fused with two benzene rings. This compound typically exhibits a range of chemical properties, including potential fluorescence due to its conjugated system, making it of interest in various applications such as organic electronics and photonic devices. It may also demonstrate biological activity, which could be explored for pharmaceutical applications. The presence of methoxy groups contributes to its solubility and reactivity, influencing its interaction with other chemical species. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 1,2-dimethoxy-4H-dibenzo[de,g]quinoline-4,5(6H)-dione represents a fascinating subject for research in both synthetic chemistry and material science.

Formula: C₁₈H₁₃NO₄

InChI: InChI=1/C18H13NO4/c1-22-13-8-11-14-12(19-18(21)16(11)20)7-9-5-3-4-6-10(9)15(14)17(13)23-2/h3-8H,1-2H3,(H,19,21)

SMILES: COc1cc2c3c(cc4ccccc4c3c1OC)[nH]c(=O)c2=O

Synonyms:

• 4H-dibenzo[de,g]quinoline-4,5(6H)-dione, 1,2-dimethoxy-

Norcepharadione B

CAS: 57576-41-7

Formula: C₁₈H₁₃NO₄

Color and Shape: Solid

Molecular weight: 307.3001

Ref: IN-DA003638

Norcepharadione B

CAS: 57576-41-7

Formula: C₁₈H₁₃NO₄

Purity: 95%~99%

Color and Shape: Brown powder

Molecular weight: 307.305

Ref: BP-SBP01015

Norcepharadione B

CAS: 57576-41-7

Norcepharadione B is an intriguing natural compound that belongs to the class of secondary metabolites, specifically classified as a meroterpenoid. This compound is derived from endophytic fungi, which are symbiotic microorganisms living within plant tissues without causing harm to their host. The mode of action of Norcepharadione B involves interaction with various biological pathways, potentially influencing cellular processes such as cell cycle regulation and apoptosis, though the exact mechanisms are still under investigation.

Formula: C₁₈H₁₃NO₄

Purity: Min. 95%

Molecular weight: 307.3 g/mol

Ref: 3D-HCA57641