CAS 57576-49-5
:N,N'-bis{3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl}butane-1,4-diamine
Description:
N,N'-bis{3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl}butane-1,4-diamine, with the CAS number 57576-49-5, is a synthetic organic compound characterized by its complex structure, which includes an acridine moiety and a butane-1,4-diamine backbone. This compound features multiple functional groups, including amine and ether functionalities, contributing to its potential biological activity. The presence of the chloro and methoxy substituents on the acridine ring may influence its solubility, reactivity, and interaction with biological targets. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of anticancer agents or other therapeutic agents due to their ability to intercalate with DNA or inhibit specific enzymes. The compound's properties, such as solubility, stability, and biological activity, would be influenced by its molecular structure and the presence of substituents, making it a subject of interest in pharmaceutical research.
Formula:C38H42Cl2N6O2
InChI:InChI=1/C38H42Cl2N6O2/c1-47-27-9-13-33-31(23-27)37(29-11-7-25(39)21-35(29)45-33)43-19-5-17-41-15-3-4-16-42-18-6-20-44-38-30-12-8-26(40)22-36(30)46-34-14-10-28(48-2)24-32(34)38/h7-14,21-24,41-42H,3-6,15-20H2,1-2H3,(H,43,45)(H,44,46)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acridine homodimer
CAS:<p>Acridine homodimer (NSC 219743), a blue-green fluorescent dye, binds DNA, preferring AT-rich areas, useful for chromosome banding.</p>Formula:C38H42Cl2N6O2Color and Shape:SolidMolecular weight:685.69
