CAS 5759-79-5

6-(benzylamino)-3-methylpyrimidine-2,4(1H,3H)-dione

Description:

6-(Benzylamino)-3-methylpyrimidine-2,4(1H,3H)-dione, with the CAS number 5759-79-5, is a chemical compound characterized by its pyrimidine core structure, which features a methyl group and a benzylamino substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in polar organic solvents due to the presence of the amino group. It is known for its biological activity, often studied for its role in medicinal chemistry, particularly as a potential pharmaceutical agent. The presence of the diketone functional groups contributes to its reactivity, allowing for various chemical transformations. Additionally, the compound may exhibit tautomerism due to the keto-enol equilibrium, influencing its stability and reactivity. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug design and development. Overall, 6-(benzylamino)-3-methylpyrimidine-2,4(1H,3H)-dione is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₂H₁₃N₃O₂

InChI: InChI=1/C12H13N3O2/c1-15-11(16)7-10(14-12(15)17)13-8-9-5-3-2-4-6-9/h2-7,13H,8H2,1H3,(H,14,17)

SMILES: Cn1c(=O)cc(NCc2ccccc2)nc1O

Synonyms:

• 2,4(1H,3H)-Pyrimidinedione, 3-methyl-6-[(phenylmethyl)amino]-
• 4(3H)-pyrimidinone, 2-hydroxy-3-methyl-6-[(phenylmethyl)amino]-

6-(Benzylamino)-3-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione

CAS: 5759-79-5

6-(Benzylamino)-3-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione (BMPT) is a synthetic cytokinin that belongs to the group of 6-benzylaminopurines. BMPT is an inhibitor of cytokinin receptor kinases, as it is a benzyl uracil derivative. BMPT can be used as a building block for the synthesis of other compounds and has been used as an inhibitor of cell growth in various organisms.

Formula: C₁₂H₁₃N₃O₂

Purity: Min. 95%

Molecular weight: 231.25 g/mol

Ref: 3D-FAA75979