CymitQuimica logo

CAS 57591-61-4

:

(R)-Amino-(4-hydroxyphenyl)acetic acid methyl ester hydrochloride

Description:
(R)-Amino-(4-hydroxyphenyl)acetic acid methyl ester hydrochloride, commonly known as L-DOPA methyl ester hydrochloride, is a chemical compound that serves as a precursor in the biosynthesis of neurotransmitters, particularly dopamine. It is characterized by its chiral nature, with the (R) configuration indicating its specific stereochemistry, which is crucial for its biological activity. The compound features an amino group, a hydroxyl group on the phenyl ring, and an ester functional group, contributing to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. L-DOPA methyl ester is primarily used in research and therapeutic contexts, particularly in the treatment of Parkinson's disease, where it helps to replenish dopamine levels in the brain. Its pharmacological properties include its ability to cross the blood-brain barrier, which is essential for its effectiveness in neurological applications. Overall, this compound is significant in both medicinal chemistry and neuropharmacology.
Formula:C9H12ClNO3
InChI:InChI=1/C9H11NO3.ClH/c1-13-9(12)6-10-7-2-4-8(11)5-3-7;/h2-5,10-11H,6H2,1H3;1H
InChI key:UYCKVJUNDXPDJH-DDWIOCJRSA-N
SMILES:COC(=O)CNc1ccc(cc1)O.Cl
Synonyms:
  • D-p-Hydroxyphenylglycine methyl ester hydrochloride
  • D-4-Hydroxyphenylglycine methyl ester hydrochloride
  • methyl N-(4-hydroxyphenyl)glycinate hydrochloride
Found 7 products.