CAS 57592-42-4

2'-Fluorobiphenyl-4-carbaldehyde

Description:

2'-Fluorobiphenyl-4-carbaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 2' position of one of the phenyl rings and an aldehyde functional group (-CHO) at the 4-position of the other ring significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The fluorine substituent can enhance the compound's lipophilicity and influence its electronic properties, making it of interest in various fields, including pharmaceuticals and materials science. Additionally, 2'-Fluorobiphenyl-4-carbaldehyde may exhibit interesting photophysical properties, which can be exploited in organic electronics and dye applications. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.

Formula: C₁₃H₉FO

InChI: InChI=1/C13H9FO/c14-13-4-2-1-3-12(13)11-7-5-10(9-15)6-8-11/h1-9H

SMILES: c1ccc(c(c1)c1ccc(cc1)C=O)F

Synonyms:

• 2'-Fluoro-[1,1'-biphenyl]-4-carboxaldehyde

2'-Fluorobiphenyl-4-carbaldehyde

CAS: 57592-42-4

Formula: C₁₃H₉FO

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.2084

Ref: IN-DA00E8WS

2'-Fluoro-[1,1'-biphenyl]-4-carboxaldehyde

CAS: 57592-42-4

2'-Fluoro-[1,1'-biphenyl]-4-carboxaldehyde

Purity: 95%

Molecular weight: 200.21g/mol

Ref: 54-PC11131

2′-Fluorobiphenyl-4-carbaldehyde

CAS: 57592-42-4

Formula: C₁₃H₉FO

Purity: ≥97%

Color and Shape: Solid

Molecular weight: 200.212

Ref: 10-F014306