CAS 57598-33-1
:2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline
Description:
2-(2-Methoxyphenyl)-4,4-dimethyl-2-oxazoline is an organic compound characterized by its oxazoline ring, which is a five-membered heterocyclic structure containing one nitrogen and one oxygen atom. This compound features a methoxy-substituted phenyl group, contributing to its aromatic properties and potential for various chemical interactions. The presence of two methyl groups at the 4-position of the oxazoline ring enhances its steric bulk and may influence its reactivity and solubility. Typically, compounds like this can exhibit interesting properties such as chirality, which can be significant in applications like pharmaceuticals or materials science. The oxazoline moiety is known for its ability to participate in polymerization reactions, making this compound potentially useful in the synthesis of polymers or as a ligand in coordination chemistry. Additionally, the methoxy group can affect the electronic properties of the molecule, influencing its behavior in chemical reactions and interactions with other substances. Overall, this compound's unique structure suggests a range of potential applications in various fields of chemistry.
Formula:C12H15NO2
InChI:InChI=1/C12H15NO2/c1-12(2)8-15-11(13-12)9-6-4-5-7-10(9)14-3/h4-7H,8H2,1-3H3
SMILES:CC1(C)COC(=N1)c1ccccc1OC
Synonyms:- 2-(2-Methoxyphenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole
- Nsc 333420
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Methoxyphenyl)-4,4-dimethyl-2-oxazoline
CAS:Formula:C12H15NO2Purity:%Color and Shape:SolidMolecular weight:205.25302-(2-Methoxyphenyl)-4,4-dimethyl-4,5-dihydrooxazole
CAS:2-(2-Methoxyphenyl)-4,4-dimethyl-4,5-dihydrooxazolePurity:95%Molecular weight:205.26g/mol4,5-DIHYDRO-2-(2-METHOXYPHENYL)-4,4-DIMETHYLOXAZOLE
CAS:Formula:C12H15NO2Purity:95%Color and Shape:SolidMolecular weight:205.2572-(2-Methoxyphenyl)-4,4-dimethyl-4,5-dihydrooxazole
CAS:Applications 2-(2-Methoxyphenyl)-4,4-dimethyl-4,5-dihydrooxazole is an intermediate in the synthesis of Candesartan-d4, the labeled analogue of Candesartan (C175575), an angiotensin II type-1 receptor antagonist. Used in treatment of congestive heart failure. Antihypertensive.
References Kaur, N., et al.: Bioorg. Med. Chem., 16, 10210 (2008); Funao, K., et al.: Mol. Med. Rep., 2, 193 (2009); Yoshikawa, M., et al.: J. Cardiovas. Pharmacol., 53, 179 (2009); Palaniyappan, A., et al.: Mol. Cell. Biochem., 321, 9 (2009)Formula:C12H15NO2Color and Shape:NeatMolecular weight:205.25



