CAS 576-36-3
:D-Galactonic acid
Description:
D-Galactonic acid is a naturally occurring sugar acid derived from galactose, classified as an aldonic acid. It features a carboxylic acid functional group (-COOH) attached to the C1 carbon of the galactose molecule, which contributes to its acidic properties. This compound is typically found in various biological systems and can be produced through the oxidation of galactose. D-Galactonic acid is a white, crystalline solid that is soluble in water, making it useful in biochemical applications. Its structure includes multiple hydroxyl (-OH) groups, which enhance its reactivity and ability to form esters and other derivatives. The acid plays a role in carbohydrate metabolism and can be involved in the synthesis of polysaccharides. Additionally, it has potential applications in food and pharmaceutical industries due to its functional properties. As with many organic acids, D-galactonic acid can participate in various chemical reactions, including esterification and salt formation, which are important for its utility in different chemical contexts.
Formula:C6H12O7
InChI:InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4+,5-/m1/s1
InChI key:InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-N
SMILES:[C@H]([C@H]([C@@H](CO)O)O)([C@H](C(O)=O)O)O
Synonyms:- (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
- <span class="text-smallcaps">D</span>-Galactonic acid
- Galactonic acid, <span class="text-smallcaps">D</span>-
- Galactonicacid, D- (8CI)
- Galactonic acid, D-
- D-Galactonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
D-Galactonic Acid-d6
CAS:Controlled ProductFormula:C6D6H6O7Color and Shape:NeatMolecular weight:202.192D-Galactonic acid-d6
CAS:D-Galactonic acid-d6 is a medicinal compound that acts as an inhibitor of protein kinases. It has been shown to induce apoptosis in human and Chinese hamster ovary cells, making it a promising candidate for use in the treatment of various types of cancer. This compound is an analog of D-galactonic acid and is labeled with deuterium, which makes it useful for studying the metabolism and pharmacokinetics of other compounds. In addition to its anticancer properties, D-Galactonic acid-d6 has potential applications as a tumor marker in urine samples. Its ability to block kinase activity may also make it useful in the development of new kinase inhibitors for cancer therapy.Formula:C6H12O7Purity:Min. 95%Molecular weight:196.16 g/mol

