CAS 5760-20-3
:2-Quinolinemethanamine
Description:
2-Quinolinemethanamine, with the CAS number 5760-20-3, is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. This substance features an amine functional group (-NH2) attached to a methylene (-CH2-) bridge linked to the quinoline moiety. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. The compound exhibits basic properties due to the presence of the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. 2-Quinolinemethanamine is of interest in medicinal chemistry and may have applications in the synthesis of pharmaceuticals or as a building block for more complex organic molecules. Its solubility in organic solvents and potential reactivity make it a valuable compound in research and industrial applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H10N2
InChI:InChI=1/C10H10N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H,7,11H2
SMILES:c1ccc2c(c1)ccc(CN)n2
Synonyms:- 1-Quinolin-2-ylmethanamine
- Quinolin-2-ylmethylamine
- quinolin-2-ylmethanamine dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Aminomethyl)quinoline
CAS:2-(Aminomethyl)quinolineFormula:C10H10N2Purity:95%Color and Shape: brown solidMolecular weight:158.20g/molQuinolin-2-yl-methylamine
CAS:Quinolin-2-yl-methylamine is an amine that is used in the synthesis of other compounds. It can be prepared by protonation of quinoline with methylamine, followed by crystallization. The yield of this reaction is dependent on the purity of the starting materials and the reaction conditions. This compound has a molecular weight of 169.07 g/mol and a melting point at 217 °C. The infrared spectrum for Quinolin-2-yl-methylamine shows peaks at 2900 cm−1, 1670 cm−1, and 1590 cm−1. It also has x-ray crystallography data (space group P21/c).Formula:C10H10N2Purity:Min. 96 Area-%Color and Shape:PowderMolecular weight:158.2 g/mol



