CAS 57615-05-1

Ethyl 1,2-dihydro-5-methyl-2-oxopyrazolo[1,5-a]pyrimidine-6-carboxylate

Description:

Ethyl 1,2-dihydro-5-methyl-2-oxopyrazolo[1,5-a]pyrimidine-6-carboxylate is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. It is often synthesized through multi-step organic reactions involving the condensation of appropriate precursors. The presence of the ethyl ester group contributes to its solubility and reactivity, while the carbonyl and methyl substituents can influence its pharmacological properties. The compound's molecular structure allows for potential interactions with biological targets, which may lead to various therapeutic applications. Additionally, its stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many heterocycles, it may also exhibit interesting spectroscopic properties, making it suitable for characterization using techniques like NMR and mass spectrometry. Overall, this compound represents a valuable scaffold in the development of new pharmaceuticals.

Formula: C₁₀H₁₁N₃O₃

InChI: InChI=1S/C10H11N3O3/c1-3-16-10(15)7-5-13-8(11-6(7)2)4-9(14)12-13/h4-5H,3H2,1-2H3,(H,12,14)

InChI key: InChIKey=ZUAAVNLKGAEZDG-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CN2C(N=C1C)=CC(=O)N2

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 1,2-dihydro-5-methyl-2-oxo-, ethyl ester
• Ethyl 1,2-dihydro-5-methyl-2-oxopyrazolo[1,5-a]pyrimidine-6-carboxylate

Pyrazophos Impurity 1

CAS: 57615-05-1

Formula: C₁₀H₁₁N₃O₃

Color and Shape: White To Off-White Solid

Molecular weight: 221.22

Ref: 4Z-P-379003