CAS 57615-42-6

3,4-dichlorobicyclo[3.2.1]oct-2-ene

Description:

3,4-Dichlorobicyclo[3.2.1]oct-2-ene is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[3.2.1]octane framework with two chlorine substituents at the 3 and 4 positions and a double bond between the 2 and 3 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the double bond, which can participate in various chemical reactions, including electrophilic additions. The chlorine atoms contribute to its polar nature, affecting its solubility in organic solvents and its overall reactivity. 3,4-Dichlorobicyclo[3.2.1]oct-2-ene may be used in synthetic organic chemistry as an intermediate for the preparation of more complex molecules. Safety considerations should be taken into account when handling this compound, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₈H₁₀Cl₂

InChI: InChI=1/C8H10Cl2/c9-7-4-5-1-2-6(3-5)8(7)10/h4-6,8H,1-3H2

SMILES: C1CC2CC1C=C(C2Cl)Cl

Synonyms:

• 3,4-Dichlorobicyclo[3.2.1]oct-2-ene

3,4-Dichlorobicyclo[3.2.1]oct-2-ene

Controlled Product

CAS: 57615-42-6

Formula: C₈H₁₀Cl₂

Color and Shape: Neat

Molecular weight: 177.071

Ref: TR-D433420