CAS 5762-64-1

2-Hydroxy-6-methylquinoxaline

Description:

2-Hydroxy-6-methylquinoxaline is an organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. This compound features a hydroxyl group (-OH) at the 2-position and a methyl group (-CH3) at the 6-position of the quinoxaline ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Its molecular structure allows for various chemical reactions, making it a useful intermediate in organic synthesis. Additionally, 2-hydroxy-6-methylquinoxaline can participate in hydrogen bonding due to the hydroxyl group, influencing its reactivity and interactions with other molecules. As with many organic compounds, safety precautions should be taken when handling it, as its specific toxicity and environmental impact may vary.

Formula: C₉H₈N₂O

InChI: InChI=1/C9H8N2O/c1-6-2-3-7-8(4-6)10-5-9(12)11-7/h2-5H,1H3,(H,11,12)

SMILES: Cc1ccc2c(c1)ncc(=O)[nH]2

Synonyms:

• 6-methylquinoxalin-2(1H)-one

2-Hydroxy-6-methylquinoxaline

CAS: 5762-64-1

2-Hydroxy-6-methylquinoxaline

Purity: ≥95%

Molecular weight: 160.17g/mol

Ref: 54-OR11195