CAS 57625-08-8
:2-Azatricyclo[3.3.1.13,7]dec-2-yloxidanyl
Description:
2-Azatricyclo[3.3.1.13,7]dec-2-yloxidanyl, with the CAS number 57625-08-8, is a chemical compound characterized by its unique bicyclic structure, which includes a nitrogen atom integrated into a tricyclic framework. This compound features a hydroxyl group (-OH) that is part of an ether linkage, contributing to its reactivity and potential applications in organic synthesis. The presence of the azatricycle indicates that it may exhibit interesting properties related to its nitrogen content, such as basicity or nucleophilicity. Additionally, the compound's stereochemistry can influence its biological activity and interactions with other molecules. While specific physical properties such as melting point, boiling point, and solubility may vary, compounds of this type are often studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic reactions. Understanding the reactivity and stability of such compounds is crucial for their application in various chemical processes.
Formula:C9H14NO
InChI:InChI=1S/C9H14NO/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2
SMILES:C1C2CC3CC1CC(C2)N3O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Azaadamantane-N-oxyl
CAS:2-Azaadamantane-N-oxyl (AZADO) is a compound known for its antioxidative activity, capable of efficiently scavenging free radicals. It has been extensively studied in compound development, demonstrating potential inhibitory effects against various diseases. The structure of AZADO lends itself to excellent biocompatibility, making it suitable for screening in innovative compound development.Formula:C9H14NOColor and Shape:SolidMolecular weight:152.212-Azaadamantane-N-oxyl
CAS:2-Azaadamantane-N-oxyl is a chemical compound that belongs to the class of aliphatic hydrocarbons. It has been shown to have carboxylate properties and is crystalline in nature. 2-Azaadamantane-N-oxyl is also known to be an effective supramolecular catalyst for cellulose, which is a complex carbohydrate polymer. Cellulose can be broken down into its component parts with 2-azaadamantane-N-oxyl as a catalyst, yielding primary alcohols, fatty acids, and other byproducts. The reaction time for this process varies depending on the desired product yield and the oxidation potential of the catalyst. The oxidation potential of 2-azaadamantane-N-oxyl can be adjusted by adding reducing agents during the reaction process.
Formula:C9H14NOPurity:(%) Min. 94%Color and Shape:PowderMolecular weight:152.21 g/mol


