CAS 57636-32-5
:2-(2′-Hydroxyphenyl)imidazo[1,2-a]pyridine
Description:
2-(2′-Hydroxyphenyl)imidazo[1,2-a]pyridine, with the CAS number 57636-32-5, is a heterocyclic organic compound characterized by its imidazo and pyridine rings fused together, along with a hydroxyl-substituted phenyl group. This compound typically exhibits a pale to dark solid appearance and is soluble in organic solvents, reflecting its aromatic nature. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. The presence of the hydroxyl group enhances its reactivity and ability to form hydrogen bonds, which can influence its interaction with biological targets. Additionally, the imidazo and pyridine moieties contribute to its electronic properties, potentially affecting its absorption and emission characteristics in various applications. Overall, 2-(2′-Hydroxyphenyl)imidazo[1,2-a]pyridine is a compound of significant interest for research in both organic synthesis and pharmacology.
Formula:C13H10N2O
InChI:InChI=1S/C13H10N2O/c16-12-6-2-1-5-10(12)11-9-15-8-4-3-7-13(15)14-11/h1-9,16H
InChI key:InChIKey=FURHXLBXCVQCNL-UHFFFAOYSA-N
SMILES:OC1=C(C2=CN3C(=N2)C=CC=C3)C=CC=C1
Synonyms:- 2-(2′-Hydroxyphenyl)imidazo[1,2-a]pyridine
- 2-(2-Hydroxyphenyl)imidazo[1,2-a]pyridine
- Imidazo[1,2-a]pyridine, phenol deriv.
- 2-Imidazo[1,2-a]pyridin-2-ylphenol
- Phenol, 2-imidazo[1,2-a]pyridin-2-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
