CAS 57637-97-5
:P-[(Acetylamino)methyl]phosphonic acid
Description:
P-[(Acetylamino)methyl]phosphonic acid, with the CAS number 57637-97-5, is a phosphonic acid derivative characterized by the presence of an acetylamino group attached to a phosphonic acid moiety. This compound typically exhibits properties associated with phosphonic acids, including high solubility in water and the ability to form stable complexes with metal ions. It is often utilized in agricultural applications, particularly as a herbicide or plant growth regulator, due to its ability to influence plant metabolism. The acetylamino group enhances its biological activity and may contribute to its effectiveness in inhibiting specific enzymatic pathways. Additionally, the compound may exhibit low toxicity to non-target organisms, making it a candidate for environmentally friendly agricultural practices. Its chemical structure allows for potential interactions with various biological systems, which can be leveraged in both agricultural and pharmaceutical contexts. Overall, P-[(Acetylamino)methyl]phosphonic acid represents a significant compound in the field of agrochemicals and biochemistry.
Formula:C3H8NO4P
InChI:InChI=1S/C3H8NO4P/c1-3(5)4-2-9(6,7)8/h2H2,1H3,(H,4,5)(H2,6,7,8)
InChI key:InChIKey=FDNUAHPLMXZWLS-UHFFFAOYSA-N
SMILES:C(P(=O)(O)O)NC(C)=O
Synonyms:- Phosphonic acid, (acetamidomethyl)-
- Phosphonic acid, [(acetylamino)methyl]-
- N-Acetylaminomethylphosphonic acid
- Phosphonic acid, P-[(acetylamino)methyl]-
- P-[(Acetylamino)methyl]phosphonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Aminomethyl phosphonic acid N-acetyl 100 µg/mL in Acetonitrile:Water
CAS:Formula:C3H8NO4PColor and Shape:Single SolutionMolecular weight:153.07Aminomethyl phosphonic acid N-acetyl
CAS:Controlled ProductFormula:C3H8NO4PColor and Shape:NeatMolecular weight:153.07N-Acetylaminomethylphosphoric Acid-d3 (Major)
CAS:Controlled Product<p>Applications Isotope labelled N-Acetylaminomethylphosphoric Acid is been found to show inhibitory properties towards ureases.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Berlicki, L. et al.: Amino Acids, 42, 1937 (2012);<br></p>Formula:C3H5D3NO4PColor and Shape:Off-WhiteMolecular weight:156.09N-Acetylaminomethylphosphoric Acid
CAS:Controlled Product<p>Applications N-Acetylaminomethylphosphoric Acid is been found to show inhibitory properties towards ureases.<br>References Berlicki, L. et al.: Amino Acids, 42, 1937 (2012);<br></p>Formula:C3H8NO4PPurity:>90%Color and Shape:Off-WhiteMolecular weight:153.07N-Acetylaminomethylphosphonic acid
CAS:<p>N-Acetylaminomethylphosphonic acid is a benzylcompound with an amide group on the nitrogen atom. It has three resonance structures, two of which are shown below.</p>Formula:C3H8NO4PPurity:Min. 95%Color and Shape:White PowderMolecular weight:153.07 g/mol



