CAS 57642-07-6

1-(1H-indol-3-yl)-2-methylpropan-1-one

Description:

1-(1H-indol-3-yl)-2-methylpropan-1-one, also known as 3-(1H-indol-3-yl)-2-methylpropan-1-one, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and is soluble in organic solvents. The presence of the indole moiety suggests potential biological activity, as indole derivatives are known for their roles in pharmaceuticals and natural products. The compound may exhibit properties such as fluorescence or photochemical reactivity, making it of interest in various fields, including medicinal chemistry and materials science. Its CAS number, 57642-07-6, allows for easy identification and reference in chemical databases. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₂H₁₃NO

InChI: InChI=1/C12H13NO/c1-8(2)12(14)10-7-13-11-6-4-3-5-9(10)11/h3-8,13H,1-2H3

SMILES: CC(C)C(=O)c1c[nH]c2ccccc12

1-(1H-indol-3-yl)-2-methyl-1-propanone

CAS: 57642-07-6

Formula: C₁₂H₁₃NO

Molecular weight: 187.2377

Ref: IN-DA00EEDB

1-(1H-indol-3-yl)-2-methyl-1-propanone

CAS: 57642-07-6

Formula: C₁₂H₁₃NO

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 187.242

Ref: 10-F315904