CAS 57658-79-4

1,4-dimethyl-5-nitro-1H-imidazole

Description:

1,4-Dimethyl-5-nitro-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 1 and 4 positions and a nitro group at the 5 position, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols. The presence of the nitro group enhances its reactivity, making it a potential candidate for various chemical reactions, including nitration and reduction processes. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, making it a subject of study in medicinal chemistry. Safety data should be consulted for handling and usage, as nitro compounds can pose health risks. Overall, 1,4-dimethyl-5-nitro-1H-imidazole is a versatile compound with applications in both research and industry.

Formula: C₅H₇N₃O₂

InChI: InChI=1/C5H7N3O2/c1-4-5(8(9)10)7(2)3-6-4/h3H,1-2H3

SMILES: Cc1c(n(C)cn1)N(=O)=O

Synonyms:

• 1,4-Dimethyl-5-nitro-1H-imidazole (9CI)

1,4-Dimethyl-5-nitroimidazole

CAS: 57658-79-4

Formula: C₅H₇N₃O₂

Purity: 98%

Molecular weight: 141.1280

Ref: IN-DA003DOS

1,4-Dimethyl-5-nitroimidazole

CAS: 57658-79-4

1,4-Dimethyl-5-nitroimidazole

Purity: 95%

Molecular weight: 141.13g/mol

Ref: 54-OR924230