CymitQuimica logo

CAS 5767-35-1

:

4-Chloro-6-hydrazinopyrimidine

Description:
4-Chloro-6-hydrazinopyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a hydrazine group (-NH-NH2) at the 6-position contributes to its reactivity and potential applications in various chemical syntheses. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazine functional group. It is often utilized in the synthesis of pharmaceuticals and agrochemicals, particularly as an intermediate in the production of more complex molecules. The hydrazine moiety can participate in various chemical reactions, including condensation and oxidation, making it a versatile building block in organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks, including potential toxicity and reactivity with other substances.
Formula:C4H5ClN4
InChI:InChI=1S/C4H5ClN4/c5-3-1-4(9-6)8-2-7-3/h1-2H,6H2,(H,7,8,9)
InChI key:NYXYZCSAJZLFEH-UHFFFAOYSA-N
SMILES:C1=C(N=CN=C1Cl)NN
Found 4 products.