CAS 57678-38-3

2-chloro-N-[4-(dimethylamino)benzyl]acetamide

Description:

2-Chloro-N-[4-(dimethylamino)benzyl]acetamide, with the CAS number 57678-38-3, is an organic compound characterized by its amide functional group and the presence of a chloro substituent. This compound features a dimethylamino group, which contributes to its basicity and potential for forming hydrogen bonds. The chloro group enhances its reactivity, making it useful in various chemical syntheses. Typically, this compound appears as a solid or crystalline substance, and its solubility can vary depending on the solvent used, often being more soluble in polar solvents due to the presence of the amide group. The compound may exhibit biological activity, which can be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₅ClN₂O

InChI: InChI=1/C11H15ClN2O/c1-14(2)10-5-3-9(4-6-10)8-13-11(15)7-12/h3-6H,7-8H2,1-2H3,(H,13,15)

SMILES: CN(C)c1ccc(cc1)CN=C(CCl)O

2-Chloro-N-{[4-(dimethylamino)phenyl]methyl}acetamide

CAS: 57678-38-3

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 226.7 g/mol

Ref: 3D-HCA67838